C16H16Cl2N2O2 — CID 154451516
1-(2,3-dichlorophenyl)-1-(2-hydroxy-4-propan-2-ylphenyl)urea (PubChem CID 154451516) has the molecular formula C16H16Cl2N2O2 and a molecular weight of 339.22 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-1-(2-hydroxy-4-propan-2-ylphenyl)urea.
| Compound Name | 1-(2,3-dichlorophenyl)-1-(2-hydroxy-4-propan-2-ylphenyl)urea |
|---|---|
| PubChem CID | 154451516 |
| Molecular Formula | C16H16Cl2N2O2 |
| Molecular Weight | 339.22 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-1-(2-hydroxy-4-propan-2-ylphenyl)urea |
| SMILES | CC(C)c1ccc(N(C(N)=O)c2cccc(Cl)c2Cl)c(O)c1 |
| InChI | InChI=1S/C16H16Cl2N2O2/c1-9(2)10-6-7-12(14(21)8-10)20(16(19)22)13-5-3-4-11(17)15(13)18/h3-9,21H,1-2H3,(H2,19,22) |
| InChIKey | XPQRCZQIBHESRL-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.22 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |