C22H30N2O — CID 141049906
1-[2,6-di(propan-2-yl)phenyl]-1-(4-propan-2-ylphenyl)urea (PubChem CID 141049906) has the molecular formula C22H30N2O and a molecular weight of 338.50 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-1-(4-propan-2-ylphenyl)urea.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-1-(4-propan-2-ylphenyl)urea |
|---|---|
| PubChem CID | 141049906 |
| Molecular Formula | C22H30N2O |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-1-(4-propan-2-ylphenyl)urea |
| SMILES | CC(C)c1ccc(N(C(N)=O)c2c(C(C)C)cccc2C(C)C)cc1 |
| InChI | InChI=1S/C22H30N2O/c1-14(2)17-10-12-18(13-11-17)24(22(23)25)21-19(15(3)4)8-7-9-20(21)16(5)6/h7-16H,1-6H3,(H2,23,25) |
| InChIKey | JACYSXDMCCTKFX-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |