C19H39ClN2O3 — CID 154451765
1-[butyl-(3-chloro-2-hydroxypropyl)amino]-3-(2,2,6,6-tetramethylpiperidin-4-yl)oxypropan-2-ol (PubChem CID 154451765) has the molecular formula C19H39ClN2O3 and a molecular weight of 378.99 g/mol. Its IUPAC name is 1-[butyl-(3-chloro-2-hydroxypropyl)amino]-3-(2,2,6,6-tetramethylpiperidin-4-yl)oxypropan-2-ol.
| Compound Name | 1-[butyl-(3-chloro-2-hydroxypropyl)amino]-3-(2,2,6,6-tetramethylpiperidin-4-yl)oxypropan-2-ol |
|---|---|
| PubChem CID | 154451765 |
| Molecular Formula | C19H39ClN2O3 |
| Molecular Weight | 378.99 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | 1-[butyl-(3-chloro-2-hydroxypropyl)amino]-3-(2,2,6,6-tetramethylpiperidin-4-yl)oxypropan-2-ol |
| SMILES | CCCCN(CC(O)CCl)CC(O)COC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C19H39ClN2O3/c1-6-7-8-22(12-15(23)11-20)13-16(24)14-25-17-9-18(2,3)21-19(4,5)10-17/h15-17,21,23-24H,6-14H2,1-5H3 |
| InChIKey | YMASHRKPVJRGES-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.99 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|