C28H22ClN3O5S — CID 154451772
(6R)-3-chloro-8-oxo-4-[(2-trityloxyiminoacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 154451772) has the molecular formula C28H22ClN3O5S and a molecular weight of 548.02 g/mol. Its IUPAC name is (6R)-3-chloro-8-oxo-4-[(2-trityloxyiminoacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-3-chloro-8-oxo-4-[(2-trityloxyiminoacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 154451772 |
| Molecular Formula | C28H22ClN3O5S |
| Molecular Weight | 548.02 g/mol |
| Exact Mass | 547.10 |
| IUPAC Name | (6R)-3-chloro-8-oxo-4-[(2-trityloxyiminoacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | O=C(C=NOC(c1ccccc1)(c1ccccc1)c1ccccc1)NC1S[C@@H]2CC(=O)N2C(C(=O)O)=C1Cl |
| InChI | InChI=1S/C28H22ClN3O5S/c29-24-25(27(35)36)32-22(34)16-23(32)38-26(24)31-21(33)17-30-37-28(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15,17,23,26H,16H2,(H,31,33)(H,35,36)/t23-,26?/m1/s1 |
| InChIKey | CEBWYCYRNCLGNW-GEPVFLLWSA-N |
| XLogP | 4.26 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.02 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|