C24H21N3O7S — CID 70185705
(6R)-3-ethenyl-4-[[3-(4-nitrophenyl)-2-phenoxypropanoyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 70185705) has the molecular formula C24H21N3O7S and a molecular weight of 495.51 g/mol. Its IUPAC name is (6R)-3-ethenyl-4-[[3-(4-nitrophenyl)-2-phenoxypropanoyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-3-ethenyl-4-[[3-(4-nitrophenyl)-2-phenoxypropanoyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 70185705 |
| Molecular Formula | C24H21N3O7S |
| Molecular Weight | 495.51 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | (6R)-3-ethenyl-4-[[3-(4-nitrophenyl)-2-phenoxypropanoyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | C=CC1=C(C(=O)O)N2C(=O)C[C@H]2SC1NC(=O)C(Cc1ccc([N+](=O)[O-])cc1)Oc1ccccc1 |
| InChI | InChI=1S/C24H21N3O7S/c1-2-17-21(24(30)31)26-19(28)13-20(26)35-23(17)25-22(29)18(34-16-6-4-3-5-7-16)12-14-8-10-15(11-9-14)27(32)33/h2-11,18,20,23H,1,12-13H2,(H,25,29)(H,30,31)/t18?,20-,23?/m1/s1 |
| InChIKey | BXBOLYKEBKGXEA-WRSRUZKNSA-N |
| XLogP | 2.86 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.51 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|