About 1H-inden-1-ide;methanidylbenzene;zirconium(3+)
1H-inden-1-ide;methanidylbenzene;zirconium(3+) (PubChem CID 154457390) has the molecular formula C23H21Zr
and a molecular weight of 388.65 g/mol. Its IUPAC name is 1H-inden-1-ide;methanidylbenzene;zirconium(3+).
Molecular Properties
| Compound Name | 1H-inden-1-ide;methanidylbenzene;zirconium(3+) |
| PubChem CID | 154457390 |
| Molecular Formula | C23H21Zr |
| Molecular Weight | 388.65 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | 1H-inden-1-ide;methanidylbenzene;zirconium(3+) |
| SMILES | [CH2-]c1ccccc1.[CH2-]c1ccccc1.[Zr+3].c1ccc2[cH-]ccc2c1 |
| InChI | InChI=1S/C9H7.2C7H7.Zr/c1-2-5-9-7-3-6-8(9)4-1;2*1-7-5-3-2-4-6-7;/h1-7H;2*2-6H,1H2;/q3*-1;+3 |
| InChIKey | WFXAZZIKPIAVBP-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.65 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1H-inden-1-ide;methanidylbenzene;zirconium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-inden-1-ide;methanidylbenzene;zirconium(3+)?
The IUPAC name of 1H-inden-1-ide;methanidylbenzene;zirconium(3+) (CID 154457390) is 1H-inden-1-ide;methanidylbenzene;zirconium(3+).
What is the SMILES notation for 1H-inden-1-ide;methanidylbenzene;zirconium(3+)?
The canonical SMILES for 1H-inden-1-ide;methanidylbenzene;zirconium(3+) is [CH2-]c1ccccc1.[CH2-]c1ccccc1.[Zr+3].c1ccc2[cH-]ccc2c1.
What is the InChIKey of 1H-inden-1-ide;methanidylbenzene;zirconium(3+)?
The InChIKey is WFXAZZIKPIAVBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7.2C7H7.Zr/c1-2-5-9-7-3-6-8(9)4-1;2*1-7-5-3-2-4-6-7;/h1-7H;2*2-6H,1H2;/q3*-1;+3.
What are the key properties of 1H-inden-1-ide;methanidylbenzene;zirconium(3+)?
1H-inden-1-ide;methanidylbenzene;zirconium(3+) has a molecular weight of 388.65 g/mol, XLogP of 6.29, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-inden-1-ide;methanidylbenzene;zirconium(3+) is sourced from PubChem (CID 154457390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).