About 1H-inden-1-ide;zirconium(3+);diphenoxide
1H-inden-1-ide;zirconium(3+);diphenoxide (PubChem CID 87733882) has the molecular formula C21H17O2Zr
and a molecular weight of 392.59 g/mol. Its IUPAC name is 1H-inden-1-ide;zirconium(3+);diphenoxide.
Molecular Properties
| Compound Name | 1H-inden-1-ide;zirconium(3+);diphenoxide |
| PubChem CID | 87733882 |
| Molecular Formula | C21H17O2Zr |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 391.03 |
| IUPAC Name | 1H-inden-1-ide;zirconium(3+);diphenoxide |
| SMILES | [O-]c1ccccc1.[O-]c1ccccc1.[Zr+3].c1ccc2[cH-]ccc2c1 |
| InChI | InChI=1S/C9H7.2C6H6O.Zr/c1-2-5-9-7-3-6-8(9)4-1;2*7-6-4-2-1-3-5-6;/h1-7H;2*1-5,7H;/q-1;;;+3/p-2 |
| InChIKey | WHKZOSHQIZIYKA-UHFFFAOYSA-L |
| XLogP | 4.08 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1H-inden-1-ide;zirconium(3+);diphenoxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-inden-1-ide;zirconium(3+);diphenoxide?
The IUPAC name of 1H-inden-1-ide;zirconium(3+);diphenoxide (CID 87733882) is 1H-inden-1-ide;zirconium(3+);diphenoxide.
What is the SMILES notation for 1H-inden-1-ide;zirconium(3+);diphenoxide?
The canonical SMILES for 1H-inden-1-ide;zirconium(3+);diphenoxide is [O-]c1ccccc1.[O-]c1ccccc1.[Zr+3].c1ccc2[cH-]ccc2c1.
What is the InChIKey of 1H-inden-1-ide;zirconium(3+);diphenoxide?
The InChIKey is WHKZOSHQIZIYKA-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H7.2C6H6O.Zr/c1-2-5-9-7-3-6-8(9)4-1;2*7-6-4-2-1-3-5-6;/h1-7H;2*1-5,7H;/q-1;;;+3/p-2.
What are the key properties of 1H-inden-1-ide;zirconium(3+);diphenoxide?
1H-inden-1-ide;zirconium(3+);diphenoxide has a molecular weight of 392.59 g/mol, XLogP of 4.08, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-inden-1-ide;zirconium(3+);diphenoxide is sourced from PubChem (CID 87733882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).