C19H25Cl2Si2Zr- — CID 154481762
dichlorozirconium;trimethyl-(7-trimethylsilyl-9H-fluoren-9-id-2-yl)silane (PubChem CID 154481762) has the molecular formula C19H25Cl2Si2Zr- and a molecular weight of 471.71 g/mol. Its IUPAC name is dichlorozirconium;trimethyl-(7-trimethylsilyl-9H-fluoren-9-id-2-yl)silane.
| Compound Name | dichlorozirconium;trimethyl-(7-trimethylsilyl-9H-fluoren-9-id-2-yl)silane |
|---|---|
| PubChem CID | 154481762 |
| Molecular Formula | C19H25Cl2Si2Zr- |
| Molecular Weight | 471.71 g/mol |
| Exact Mass | 468.99 |
| IUPAC Name | dichlorozirconium;trimethyl-(7-trimethylsilyl-9H-fluoren-9-id-2-yl)silane |
| SMILES | C[Si](C)(C)c1ccc2c(c1)[cH-]c1cc([Si](C)(C)C)ccc12.Cl[Zr]Cl |
| InChI | InChI=1S/C19H25Si2.2ClH.Zr/c1-20(2,3)16-7-9-18-14(12-16)11-15-13-17(21(4,5)6)8-10-19(15)18;;;/h7-13H,1-6H3;2*1H;/q-1;;;+2/p-2 |
| InChIKey | DUEAENSIYKWQQR-UHFFFAOYSA-L |
| XLogP | 6.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.71 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|