C20H27N3O4 — CID 154497457
[(1R,2S,4S,9R,10R,12S)-12-hydroxy-14-oxo-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-4-yl] 1H-pyrrole-2-carboxylate (PubChem CID 154497457) has the molecular formula C20H27N3O4 and a molecular weight of 373.45 g/mol. Its IUPAC name is [(1R,2S,4S,9R,10R,12S)-12-hydroxy-14-oxo-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-4-yl] 1H-pyrrole-2-carboxylate.
| Compound Name | [(1R,2S,4S,9R,10R,12S)-12-hydroxy-14-oxo-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-4-yl] 1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 154497457 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | [(1R,2S,4S,9R,10R,12S)-12-hydroxy-14-oxo-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-4-yl] 1H-pyrrole-2-carboxylate |
| SMILES | O=C(O[C@H]1CCN2C[C@H]3C[C@H](CN4C(=O)C[C@@H](O)C[C@H]34)[C@@H]2C1)c1ccc[nH]1 |
| InChI | InChI=1S/C20H27N3O4/c24-14-7-18-12-6-13(11-23(18)19(25)8-14)17-9-15(3-5-22(17)10-12)27-20(26)16-2-1-4-21-16/h1-2,4,12-15,17-18,21,24H,3,5-11H2/t12-,13-,14+,15+,17+,18-/m1/s1 |
| InChIKey | MDJQHHOIXSBKRX-NREAYSRSSA-N |
| XLogP | 1.01 |
| TPSA | 85.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |