C33H48N2O7Si — CID 154498033
2-O-[(4R,4aS,7aR,12bS)-9-[tert-butyl(dimethyl)silyl]oxy-4a-hydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 1-O-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate (PubChem CID 154498033) has the molecular formula C33H48N2O7Si and a molecular weight of 612.84 g/mol. Its IUPAC name is 2-O-[(4R,4aS,7aR,12bS)-9-[tert-butyl(dimethyl)silyl]oxy-4a-hydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 1-O-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate.
| Compound Name | 2-O-[(4R,4aS,7aR,12bS)-9-[tert-butyl(dimethyl)silyl]oxy-4a-hydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 1-O-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 154498033 |
| Molecular Formula | C33H48N2O7Si |
| Molecular Weight | 612.84 g/mol |
| Exact Mass | 612.32 |
| IUPAC Name | 2-O-[(4R,4aS,7aR,12bS)-9-[tert-butyl(dimethyl)silyl]oxy-4a-hydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 1-O-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate |
| SMILES | CN1CC[C@]23c4c5ccc(O[Si](C)(C)C(C)(C)C)c4O[C@H]2C(OC(=O)[C@@H]2CCCN2C(=O)OC(C)(C)C)=CC[C@@]3(O)[C@H]1C5 |
| InChI | InChI=1S/C33H48N2O7Si/c1-30(2,3)41-29(37)35-17-10-11-21(35)28(36)39-23-14-15-33(38)24-19-20-12-13-22(42-43(8,9)31(4,5)6)26-25(20)32(33,27(23)40-26)16-18-34(24)7/h12-14,21,24,27,38H,10-11,15-19H2,1-9H3/t21-,24+,27-,32-,33+/m0/s1 |
| InChIKey | IINHJISNLGXYCB-SMPXSLFKSA-N |
| XLogP | 5.29 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.84 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|