C32H44N4 — CID 15449887
5,10,15,20-tetraethyl-5,10,15,20-tetramethyl-21,22,23,24-tetrahydroporphyrin (PubChem CID 15449887) has the molecular formula C32H44N4 and a molecular weight of 484.73 g/mol. Its IUPAC name is 5,10,15,20-tetraethyl-5,10,15,20-tetramethyl-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 5,10,15,20-tetraethyl-5,10,15,20-tetramethyl-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 15449887 |
| Molecular Formula | C32H44N4 |
| Molecular Weight | 484.73 g/mol |
| Exact Mass | 484.36 |
| IUPAC Name | 5,10,15,20-tetraethyl-5,10,15,20-tetramethyl-21,22,23,24-tetrahydroporphyrin |
| SMILES | CCC1(C)c2ccc([nH]2)C(C)(CC)c2ccc([nH]2)C(C)(CC)c2ccc([nH]2)C(C)(CC)c2ccc1[nH]2 |
| InChI | InChI=1S/C32H44N4/c1-9-29(5)21-13-15-23(33-21)30(6,10-2)25-17-19-27(35-25)32(8,12-4)28-20-18-26(36-28)31(7,11-3)24-16-14-22(29)34-24/h13-20,33-36H,9-12H2,1-8H3 |
| InChIKey | KBVYNSSGYKYINE-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.73 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |