C13H17F3N2O3S — CID 154503973
N'-(2-methylpropyl)-N'-[3-(trifluoromethyl)phenyl]sulfonylacetohydrazide (PubChem CID 154503973) has the molecular formula C13H17F3N2O3S and a molecular weight of 338.35 g/mol. Its IUPAC name is N'-(2-methylpropyl)-N'-[3-(trifluoromethyl)phenyl]sulfonylacetohydrazide.
| Compound Name | N'-(2-methylpropyl)-N'-[3-(trifluoromethyl)phenyl]sulfonylacetohydrazide |
|---|---|
| PubChem CID | 154503973 |
| Molecular Formula | C13H17F3N2O3S |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | N'-(2-methylpropyl)-N'-[3-(trifluoromethyl)phenyl]sulfonylacetohydrazide |
| SMILES | CC(=O)NN(CC(C)C)S(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H17F3N2O3S/c1-9(2)8-18(17-10(3)19)22(20,21)12-6-4-5-11(7-12)13(14,15)16/h4-7,9H,8H2,1-3H3,(H,17,19) |
| InChIKey | UOZMJGQEEKIUJA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|