C25H24N6O — CID 15450790
N-[9-[(3-hept-1-ynylphenyl)methyl]purin-6-yl]pyridine-3-carboxamide (PubChem CID 15450790) has the molecular formula C25H24N6O and a molecular weight of 424.51 g/mol. Its IUPAC name is N-[9-[(3-hept-1-ynylphenyl)methyl]purin-6-yl]pyridine-3-carboxamide.
| Compound Name | N-[9-[(3-hept-1-ynylphenyl)methyl]purin-6-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 15450790 |
| Molecular Formula | C25H24N6O |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | N-[9-[(3-hept-1-ynylphenyl)methyl]purin-6-yl]pyridine-3-carboxamide |
| SMILES | CCCCCC#Cc1cccc(Cn2cnc3c(NC(=O)c4cccnc4)ncnc32)c1 |
| InChI | InChI=1S/C25H24N6O/c1-2-3-4-5-6-9-19-10-7-11-20(14-19)16-31-18-29-22-23(27-17-28-24(22)31)30-25(32)21-12-8-13-26-15-21/h7-8,10-15,17-18H,2-5,16H2,1H3,(H,27,28,30,32) |
| InChIKey | SSRBAODNFKPZDQ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|