C9H5F8NO — CID 154508456
2,4-difluoro-5-(1,1,2,3,3,3-hexafluoropropoxy)aniline (PubChem CID 154508456) has the molecular formula C9H5F8NO and a molecular weight of 295.13 g/mol. Its IUPAC name is 2,4-difluoro-5-(1,1,2,3,3,3-hexafluoropropoxy)aniline.
| Compound Name | 2,4-difluoro-5-(1,1,2,3,3,3-hexafluoropropoxy)aniline |
|---|---|
| PubChem CID | 154508456 |
| Molecular Formula | C9H5F8NO |
| Molecular Weight | 295.13 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 2,4-difluoro-5-(1,1,2,3,3,3-hexafluoropropoxy)aniline |
| SMILES | Nc1cc(OC(F)(F)C(F)C(F)(F)F)c(F)cc1F |
| InChI | InChI=1S/C9H5F8NO/c10-3-1-4(11)6(2-5(3)18)19-9(16,17)7(12)8(13,14)15/h1-2,7H,18H2 |
| InChIKey | FOCRDJUUPSMONF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.13 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|