C25H30OS2 — CID 154508514
1,3-bis(3-methyl-2,3,4,5-tetrahydro-1-benzothiepin-7-yl)propan-2-one (PubChem CID 154508514) has the molecular formula C25H30OS2 and a molecular weight of 410.65 g/mol. Its IUPAC name is 1,3-bis(3-methyl-2,3,4,5-tetrahydro-1-benzothiepin-7-yl)propan-2-one.
| Compound Name | 1,3-bis(3-methyl-2,3,4,5-tetrahydro-1-benzothiepin-7-yl)propan-2-one |
|---|---|
| PubChem CID | 154508514 |
| Molecular Formula | C25H30OS2 |
| Molecular Weight | 410.65 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 1,3-bis(3-methyl-2,3,4,5-tetrahydro-1-benzothiepin-7-yl)propan-2-one |
| SMILES | CC1CCc2cc(CC(=O)Cc3ccc4c(c3)CCC(C)CS4)ccc2SC1 |
| InChI | InChI=1S/C25H30OS2/c1-17-3-7-21-11-19(5-9-24(21)27-15-17)13-23(26)14-20-6-10-25-22(12-20)8-4-18(2)16-28-25/h5-6,9-12,17-18H,3-4,7-8,13-16H2,1-2H3 |
| InChIKey | VFIVJNWAGKYVOC-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.65 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |