About 1-aminoethenyl N-methylethanimidothioate
1-aminoethenyl N-methylethanimidothioate (PubChem CID 154517185) has the molecular formula C5H10N2S
and a molecular weight of 130.22 g/mol. Its IUPAC name is 1-aminoethenyl N-methylethanimidothioate.
Molecular Properties
| Compound Name | 1-aminoethenyl N-methylethanimidothioate |
| PubChem CID | 154517185 |
| Molecular Formula | C5H10N2S |
| Molecular Weight | 130.22 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | 1-aminoethenyl N-methylethanimidothioate |
| SMILES | C=C(N)S/C(C)=N/C |
| InChI | InChI=1S/C5H10N2S/c1-4(6)8-5(2)7-3/h1,6H2,2-3H3/b7-5+ |
| InChIKey | WKOHXYZHEOOSHJ-FNORWQNLSA-N |
| XLogP | 1.20 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.22 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-aminoethenyl N-methylethanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminoethenyl N-methylethanimidothioate?
The IUPAC name of 1-aminoethenyl N-methylethanimidothioate (CID 154517185) is 1-aminoethenyl N-methylethanimidothioate.
What is the SMILES notation for 1-aminoethenyl N-methylethanimidothioate?
The canonical SMILES for 1-aminoethenyl N-methylethanimidothioate is C=C(N)S/C(C)=N/C.
What is the InChIKey of 1-aminoethenyl N-methylethanimidothioate?
The InChIKey is WKOHXYZHEOOSHJ-FNORWQNLSA-N. The full InChI is InChI=1S/C5H10N2S/c1-4(6)8-5(2)7-3/h1,6H2,2-3H3/b7-5+.
What are the key properties of 1-aminoethenyl N-methylethanimidothioate?
1-aminoethenyl N-methylethanimidothioate has a molecular weight of 130.22 g/mol, XLogP of 1.20, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminoethenyl N-methylethanimidothioate is sourced from PubChem (CID 154517185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).