C28H15F11O — CID 154529771
2-[3-[4-[3,5-difluoro-4-(3,4,5-trifluorophenyl)phenyl]-3,5-difluorophenoxy]-3,3-difluoropropyl]-1,3-difluoro-5-methylbenzene (PubChem CID 154529771) has the molecular formula C28H15F11O and a molecular weight of 576.41 g/mol. Its IUPAC name is 2-[3-[4-[3,5-difluoro-4-(3,4,5-trifluorophenyl)phenyl]-3,5-difluorophenoxy]-3,3-difluoropropyl]-1,3-difluoro-5-methylbenzene.
| Compound Name | 2-[3-[4-[3,5-difluoro-4-(3,4,5-trifluorophenyl)phenyl]-3,5-difluorophenoxy]-3,3-difluoropropyl]-1,3-difluoro-5-methylbenzene |
|---|---|
| PubChem CID | 154529771 |
| Molecular Formula | C28H15F11O |
| Molecular Weight | 576.41 g/mol |
| Exact Mass | 576.09 |
| IUPAC Name | 2-[3-[4-[3,5-difluoro-4-(3,4,5-trifluorophenyl)phenyl]-3,5-difluorophenoxy]-3,3-difluoropropyl]-1,3-difluoro-5-methylbenzene |
| SMILES | Cc1cc(F)c(CCC(F)(F)Oc2cc(F)c(-c3cc(F)c(-c4cc(F)c(F)c(F)c4)c(F)c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C28H15F11O/c1-12-4-17(29)16(18(30)5-12)2-3-28(38,39)40-15-10-21(33)26(22(34)11-15)13-6-19(31)25(20(32)7-13)14-8-23(35)27(37)24(36)9-14/h4-11H,2-3H2,1H3 |
| InChIKey | LSZDSZGXOPNNBX-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.41 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|