C18H19F5N2O — CID 59048940
2-[3,3-difluoro-3-(3,4,5-trifluorophenoxy)propyl]-5-pentylpyrimidine (PubChem CID 59048940) has the molecular formula C18H19F5N2O and a molecular weight of 374.35 g/mol. Its IUPAC name is 2-[3,3-difluoro-3-(3,4,5-trifluorophenoxy)propyl]-5-pentylpyrimidine.
| Compound Name | 2-[3,3-difluoro-3-(3,4,5-trifluorophenoxy)propyl]-5-pentylpyrimidine |
|---|---|
| PubChem CID | 59048940 |
| Molecular Formula | C18H19F5N2O |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 2-[3,3-difluoro-3-(3,4,5-trifluorophenoxy)propyl]-5-pentylpyrimidine |
| SMILES | CCCCCc1cnc(CCC(F)(F)Oc2cc(F)c(F)c(F)c2)nc1 |
| InChI | InChI=1S/C18H19F5N2O/c1-2-3-4-5-12-10-24-16(25-11-12)6-7-18(22,23)26-13-8-14(19)17(21)15(20)9-13/h8-11H,2-7H2,1H3 |
| InChIKey | WSPCGHRNGFSUOM-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|