C35H43N7O6 — CID 154565548
(1R,4R,10S,14R)-4-benzyl-6-methyl-16-(1-methyl-3-phenylpyrazole-5-carbonyl)-10-(2-methylpropyl)-18-oxa-3,6,9,12,16-pentazabicyclo[12.3.1]octadecane-2,5,8,11-tetrone (PubChem CID 154565548) has the molecular formula C35H43N7O6 and a molecular weight of 657.77 g/mol. Its IUPAC name is (1R,4R,10S,14R)-4-benzyl-6-methyl-16-(1-methyl-3-phenylpyrazole-5-carbonyl)-10-(2-methylpropyl)-18-oxa-3,6,9,12,16-pentazabicyclo[12.3.1]octadecane-2,5,8,11-tetrone.
| Compound Name | (1R,4R,10S,14R)-4-benzyl-6-methyl-16-(1-methyl-3-phenylpyrazole-5-carbonyl)-10-(2-methylpropyl)-18-oxa-3,6,9,12,16-pentazabicyclo[12.3.1]octadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 154565548 |
| Molecular Formula | C35H43N7O6 |
| Molecular Weight | 657.77 g/mol |
| Exact Mass | 657.33 |
| IUPAC Name | (1R,4R,10S,14R)-4-benzyl-6-methyl-16-(1-methyl-3-phenylpyrazole-5-carbonyl)-10-(2-methylpropyl)-18-oxa-3,6,9,12,16-pentazabicyclo[12.3.1]octadecane-2,5,8,11-tetrone |
| SMILES | CC(C)C[C@@H]1NC(=O)CN(C)C(=O)[C@@H](Cc2ccccc2)NC(=O)[C@H]2CN(C(=O)c3cc(-c4ccccc4)nn3C)C[C@@H](CNC1=O)O2 |
| InChI | InChI=1S/C35H43N7O6/c1-22(2)15-27-32(44)36-18-25-19-42(35(47)29-17-26(39-41(29)4)24-13-9-6-10-14-24)20-30(48-25)33(45)38-28(16-23-11-7-5-8-12-23)34(46)40(3)21-31(43)37-27/h5-14,17,22,25,27-28,30H,15-16,18-21H2,1-4H3,(H,36,44)(H,37,43)(H,38,45)/t25-,27+,28-,30-/m1/s1 |
| InChIKey | KSTWXQKRDHMFKI-XMABBMNZSA-N |
| XLogP | 1.14 |
| TPSA | 154.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.77 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |