C25H33N7O5 — CID 154569829
(1R,4R,10R,14S)-4-benzyl-16-(1H-imidazol-5-ylmethyl)-6,10-dimethyl-18-oxa-3,6,9,12,16-pentazabicyclo[12.3.1]octadecane-2,5,8,11-tetrone (PubChem CID 154569829) has the molecular formula C25H33N7O5 and a molecular weight of 511.58 g/mol. Its IUPAC name is (1R,4R,10R,14S)-4-benzyl-16-(1H-imidazol-5-ylmethyl)-6,10-dimethyl-18-oxa-3,6,9,12,16-pentazabicyclo[12.3.1]octadecane-2,5,8,11-tetrone.
| Compound Name | (1R,4R,10R,14S)-4-benzyl-16-(1H-imidazol-5-ylmethyl)-6,10-dimethyl-18-oxa-3,6,9,12,16-pentazabicyclo[12.3.1]octadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 154569829 |
| Molecular Formula | C25H33N7O5 |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.25 |
| IUPAC Name | (1R,4R,10R,14S)-4-benzyl-16-(1H-imidazol-5-ylmethyl)-6,10-dimethyl-18-oxa-3,6,9,12,16-pentazabicyclo[12.3.1]octadecane-2,5,8,11-tetrone |
| SMILES | C[C@H]1NC(=O)CN(C)C(=O)[C@@H](Cc2ccccc2)NC(=O)[C@H]2CN(Cc3cnc[nH]3)C[C@H](CNC1=O)O2 |
| InChI | InChI=1S/C25H33N7O5/c1-16-23(34)27-10-19-12-32(11-18-9-26-15-28-18)13-21(37-19)24(35)30-20(8-17-6-4-3-5-7-17)25(36)31(2)14-22(33)29-16/h3-7,9,15-16,19-21H,8,10-14H2,1-2H3,(H,26,28)(H,27,34)(H,29,33)(H,30,35)/t16-,19+,20-,21-/m1/s1 |
| InChIKey | JVXFBXKMWKIORU-UMSONDCASA-N |
| XLogP | -1.20 |
| TPSA | 148.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |