C30H40N6O8 — CID 163334888
(1R,4R,10S,14R)-4-benzyl-6-methyl-10-(2-methylpropyl)-16-(1H-pyrrole-3-carbonyl)-18-oxa-3,6,9,12,16-pentazabicyclo[12.3.1]octadecane-2,5,8,11-tetrone;formic acid (PubChem CID 163334888) has the molecular formula C30H40N6O8 and a molecular weight of 612.68 g/mol. Its IUPAC name is (1R,4R,10S,14R)-4-benzyl-6-methyl-10-(2-methylpropyl)-16-(1H-pyrrole-3-carbonyl)-18-oxa-3,6,9,12,16-pentazabicyclo[12.3.1]octadecane-2,5,8,11-tetrone;formic acid.
| Compound Name | (1R,4R,10S,14R)-4-benzyl-6-methyl-10-(2-methylpropyl)-16-(1H-pyrrole-3-carbonyl)-18-oxa-3,6,9,12,16-pentazabicyclo[12.3.1]octadecane-2,5,8,11-tetrone;formic acid |
|---|---|
| PubChem CID | 163334888 |
| Molecular Formula | C30H40N6O8 |
| Molecular Weight | 612.68 g/mol |
| Exact Mass | 612.29 |
| IUPAC Name | (1R,4R,10S,14R)-4-benzyl-6-methyl-10-(2-methylpropyl)-16-(1H-pyrrole-3-carbonyl)-18-oxa-3,6,9,12,16-pentazabicyclo[12.3.1]octadecane-2,5,8,11-tetrone;formic acid |
| SMILES | CC(C)C[C@@H]1NC(=O)CN(C)C(=O)[C@@H](Cc2ccccc2)NC(=O)[C@H]2CN(C(=O)c3cc[nH]c3)C[C@@H](CNC1=O)O2.O=CO |
| InChI | InChI=1S/C29H38N6O6.CH2O2/c1-18(2)11-22-26(37)31-14-21-15-35(28(39)20-9-10-30-13-20)16-24(41-21)27(38)33-23(12-19-7-5-4-6-8-19)29(40)34(3)17-25(36)32-22;2-1-3/h4-10,13,18,21-24,30H,11-12,14-17H2,1-3H3,(H,31,37)(H,32,36)(H,33,38);1H,(H,2,3)/t21-,22+,23-,24-;/m1./s1 |
| InChIKey | DQDSDZRASWGXAN-NVGWGOIQSA-N |
| XLogP | -0.23 |
| TPSA | 190.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.68 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|