C32H37FN6O7S — CID 155971448
(1R,4R,10R,14S)-4-benzyl-16-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]-6,10-dimethyl-18-oxa-3,6,9,12,16-pentazabicyclo[12.3.1]octadecane-2,5,8,11-tetrone;formic acid (PubChem CID 155971448) has the molecular formula C32H37FN6O7S and a molecular weight of 668.75 g/mol. Its IUPAC name is (1R,4R,10R,14S)-4-benzyl-16-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]-6,10-dimethyl-18-oxa-3,6,9,12,16-pentazabicyclo[12.3.1]octadecane-2,5,8,11-tetrone;formic acid.
| Compound Name | (1R,4R,10R,14S)-4-benzyl-16-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]-6,10-dimethyl-18-oxa-3,6,9,12,16-pentazabicyclo[12.3.1]octadecane-2,5,8,11-tetrone;formic acid |
|---|---|
| PubChem CID | 155971448 |
| Molecular Formula | C32H37FN6O7S |
| Molecular Weight | 668.75 g/mol |
| Exact Mass | 668.24 |
| IUPAC Name | (1R,4R,10R,14S)-4-benzyl-16-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]-6,10-dimethyl-18-oxa-3,6,9,12,16-pentazabicyclo[12.3.1]octadecane-2,5,8,11-tetrone;formic acid |
| SMILES | C[C@H]1NC(=O)CN(C)C(=O)[C@@H](Cc2ccccc2)NC(=O)[C@H]2CN(Cc3nc(-c4ccc(F)cc4)cs3)C[C@H](CNC1=O)O2.O=CO |
| InChI | InChI=1S/C31H35FN6O5S.CH2O2/c1-19-29(40)33-13-23-14-38(17-28-35-25(18-44-28)21-8-10-22(32)11-9-21)15-26(43-23)30(41)36-24(12-20-6-4-3-5-7-20)31(42)37(2)16-27(39)34-19;2-1-3/h3-11,18-19,23-24,26H,12-17H2,1-2H3,(H,33,40)(H,34,39)(H,36,41);1H,(H,2,3)/t19-,23+,24-,26-;/m1./s1 |
| InChIKey | IMNIWUUVIZRRCW-ZWFJTZKQSA-N |
| XLogP | 1.04 |
| TPSA | 170.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.75 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|