C25H35N5O5 — CID 154567884
(1R,4R,10R,14S)-4-benzyl-16-(cyclopropylmethyl)-6,10-dimethyl-18-oxa-3,6,9,12,16-pentazabicyclo[12.3.1]octadecane-2,5,8,11-tetrone (PubChem CID 154567884) has the molecular formula C25H35N5O5 and a molecular weight of 485.59 g/mol. Its IUPAC name is (1R,4R,10R,14S)-4-benzyl-16-(cyclopropylmethyl)-6,10-dimethyl-18-oxa-3,6,9,12,16-pentazabicyclo[12.3.1]octadecane-2,5,8,11-tetrone.
| Compound Name | (1R,4R,10R,14S)-4-benzyl-16-(cyclopropylmethyl)-6,10-dimethyl-18-oxa-3,6,9,12,16-pentazabicyclo[12.3.1]octadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 154567884 |
| Molecular Formula | C25H35N5O5 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.26 |
| IUPAC Name | (1R,4R,10R,14S)-4-benzyl-16-(cyclopropylmethyl)-6,10-dimethyl-18-oxa-3,6,9,12,16-pentazabicyclo[12.3.1]octadecane-2,5,8,11-tetrone |
| SMILES | C[C@H]1NC(=O)CN(C)C(=O)[C@@H](Cc2ccccc2)NC(=O)[C@H]2CN(CC3CC3)C[C@H](CNC1=O)O2 |
| InChI | InChI=1S/C25H35N5O5/c1-16-23(32)26-11-19-13-30(12-18-8-9-18)14-21(35-19)24(33)28-20(10-17-6-4-3-5-7-17)25(34)29(2)15-22(31)27-16/h3-7,16,18-21H,8-15H2,1-2H3,(H,26,32)(H,27,31)(H,28,33)/t16-,19+,20-,21-/m1/s1 |
| InChIKey | CPABIRCELWMYLX-UMSONDCASA-N |
| XLogP | -0.71 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |