C16H32O4 — CID 154585555
[(2R)-2,3-dihydroxypropyl] (Z)-undec-9-enoate;ethane (PubChem CID 154585555) has the molecular formula C16H32O4 and a molecular weight of 288.43 g/mol. Its IUPAC name is [(2R)-2,3-dihydroxypropyl] (Z)-undec-9-enoate;ethane.
| Compound Name | [(2R)-2,3-dihydroxypropyl] (Z)-undec-9-enoate;ethane |
|---|---|
| PubChem CID | 154585555 |
| Molecular Formula | C16H32O4 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | [(2R)-2,3-dihydroxypropyl] (Z)-undec-9-enoate;ethane |
| SMILES | C/C=C\CCCCCCCC(=O)OC[C@H](O)CO.CC |
| InChI | InChI=1S/C14H26O4.C2H6/c1-2-3-4-5-6-7-8-9-10-14(17)18-12-13(16)11-15;1-2/h2-3,13,15-16H,4-12H2,1H3;1-2H3/b3-2-;/t13-;/m1./s1 |
| InChIKey | RNFKVCQYBFLUAR-AEKXQGFTSA-N |
| XLogP | 3.22 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|