C6H10O12S4 — CID 154586607
6-[2-(2,2,4,4-tetraoxo-1,5,2,4-dioxadithian-6-yl)ethyl]-1,5,2,4-dioxadithiane 2,2,4,4-tetraoxide (PubChem CID 154586607) has the molecular formula C6H10O12S4 and a molecular weight of 402.40 g/mol. Its IUPAC name is 6-[2-(2,2,4,4-tetraoxo-1,5,2,4-dioxadithian-6-yl)ethyl]-1,5,2,4-dioxadithiane 2,2,4,4-tetraoxide.
| Compound Name | 6-[2-(2,2,4,4-tetraoxo-1,5,2,4-dioxadithian-6-yl)ethyl]-1,5,2,4-dioxadithiane 2,2,4,4-tetraoxide |
|---|---|
| PubChem CID | 154586607 |
| Molecular Formula | C6H10O12S4 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 401.91 |
| IUPAC Name | 6-[2-(2,2,4,4-tetraoxo-1,5,2,4-dioxadithian-6-yl)ethyl]-1,5,2,4-dioxadithiane 2,2,4,4-tetraoxide |
| SMILES | O=S1(=O)CS(=O)(=O)OC(CCC2OS(=O)(=O)CS(=O)(=O)O2)O1 |
| InChI | InChI=1S/C6H10O12S4/c7-19(8)3-20(9,10)16-5(15-19)1-2-6-17-21(11,12)4-22(13,14)18-6/h5-6H,1-4H2 |
| InChIKey | AZSIEIJUJURVJA-UHFFFAOYSA-N |
| XLogP | -2.25 |
| TPSA | 173.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|