C5H8O12S4 — CID 129060929
6-[(2,2,4,4-tetraoxo-1,5,2,4-dioxadithian-6-yl)methyl]-1,5,2,4-dioxadithiane 2,2,4,4-tetraoxide (PubChem CID 129060929) has the molecular formula C5H8O12S4 and a molecular weight of 388.38 g/mol. Its IUPAC name is 6-[(2,2,4,4-tetraoxo-1,5,2,4-dioxadithian-6-yl)methyl]-1,5,2,4-dioxadithiane 2,2,4,4-tetraoxide.
| Compound Name | 6-[(2,2,4,4-tetraoxo-1,5,2,4-dioxadithian-6-yl)methyl]-1,5,2,4-dioxadithiane 2,2,4,4-tetraoxide |
|---|---|
| PubChem CID | 129060929 |
| Molecular Formula | C5H8O12S4 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 387.89 |
| IUPAC Name | 6-[(2,2,4,4-tetraoxo-1,5,2,4-dioxadithian-6-yl)methyl]-1,5,2,4-dioxadithiane 2,2,4,4-tetraoxide |
| SMILES | O=S1(=O)CS(=O)(=O)OC(CC2OS(=O)(=O)CS(=O)(=O)O2)O1 |
| InChI | InChI=1S/C5H8O12S4/c6-18(7)2-19(8,9)15-4(14-18)1-5-16-20(10,11)3-21(12,13)17-5/h4-5H,1-3H2 |
| InChIKey | BKGXNHRKVZQPDR-UHFFFAOYSA-N |
| XLogP | -2.64 |
| TPSA | 173.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|