C25H40N6O2 — CID 154593810
1-butyl-N-[3-[[(1-butyl-3-methylimidazol-3-ium-2-yl)-oxidomethylidene]amino]-4-methylcyclohexyl]-3-methylimidazol-3-ium-2-carboximidate (PubChem CID 154593810) has the molecular formula C25H40N6O2 and a molecular weight of 456.64 g/mol. Its IUPAC name is 1-butyl-N-[3-[[(1-butyl-3-methylimidazol-3-ium-2-yl)-oxidomethylidene]amino]-4-methylcyclohexyl]-3-methylimidazol-3-ium-2-carboximidate.
| Compound Name | 1-butyl-N-[3-[[(1-butyl-3-methylimidazol-3-ium-2-yl)-oxidomethylidene]amino]-4-methylcyclohexyl]-3-methylimidazol-3-ium-2-carboximidate |
|---|---|
| PubChem CID | 154593810 |
| Molecular Formula | C25H40N6O2 |
| Molecular Weight | 456.64 g/mol |
| Exact Mass | 456.32 |
| IUPAC Name | 1-butyl-N-[3-[[(1-butyl-3-methylimidazol-3-ium-2-yl)-oxidomethylidene]amino]-4-methylcyclohexyl]-3-methylimidazol-3-ium-2-carboximidate |
| SMILES | CCCCn1cc[n+](C)c1/C([O-])=N/C1CCC(C)C(/N=C(\[O-])c2n(CCCC)cc[n+]2C)C1 |
| InChI | InChI=1S/C25H40N6O2/c1-6-8-12-30-16-14-28(4)24(30)22(32)26-20-11-10-19(3)21(18-20)27-23(33)25-29(5)15-17-31(25)13-9-7-2/h14-17,19-21H,6-13,18H2,1-5H3 |
| InChIKey | ASPZISZGIHZIFM-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 88.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.64 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|