C13H20N2O5 — CID 160724922
1-butyl-3-methylimidazol-3-ium-2-carboxylate;1,3-dioxan-2-one (PubChem CID 160724922) has the molecular formula C13H20N2O5 and a molecular weight of 284.31 g/mol. Its IUPAC name is 1-butyl-3-methylimidazol-3-ium-2-carboxylate;1,3-dioxan-2-one.
| Compound Name | 1-butyl-3-methylimidazol-3-ium-2-carboxylate;1,3-dioxan-2-one |
|---|---|
| PubChem CID | 160724922 |
| Molecular Formula | C13H20N2O5 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 1-butyl-3-methylimidazol-3-ium-2-carboxylate;1,3-dioxan-2-one |
| SMILES | CCCCn1cc[n+](C)c1C(=O)[O-].O=C1OCCCO1 |
| InChI | InChI=1S/C9H14N2O2.C4H6O3/c1-3-4-5-11-7-6-10(2)8(11)9(12)13;5-4-6-2-1-3-7-4/h6-7H,3-5H2,1-2H3;1-3H2 |
| InChIKey | PSEAKPFHIMNYPK-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 84.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|