C18H21N2O13P3-4 — CID 154593931
[[[(1R,4R)-2-hydroxy-4-(5-octa-1,7-diynyl-2,4-dioxopyrimidin-1-yl)cyclopentyl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] phosphate (PubChem CID 154593931) has the molecular formula C18H21N2O13P3-4 and a molecular weight of 566.29 g/mol. Its IUPAC name is [[[(1R,4R)-2-hydroxy-4-(5-octa-1,7-diynyl-2,4-dioxopyrimidin-1-yl)cyclopentyl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] phosphate.
| Compound Name | [[[(1R,4R)-2-hydroxy-4-(5-octa-1,7-diynyl-2,4-dioxopyrimidin-1-yl)cyclopentyl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] phosphate |
|---|---|
| PubChem CID | 154593931 |
| Molecular Formula | C18H21N2O13P3-4 |
| Molecular Weight | 566.29 g/mol |
| Exact Mass | 566.03 |
| IUPAC Name | [[[(1R,4R)-2-hydroxy-4-(5-octa-1,7-diynyl-2,4-dioxopyrimidin-1-yl)cyclopentyl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] phosphate |
| SMILES | C#CCCCCC#Cc1cn([C@H]2CC(O)[C@@H](COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H25N2O13P3/c1-2-3-4-5-6-7-8-13-11-20(18(23)19-17(13)22)15-9-14(16(21)10-15)12-31-35(27,28)33-36(29,30)32-34(24,25)26/h1,11,14-16,21H,3-6,9-10,12H2,(H,27,28)(H,29,30)(H,19,22,23)(H2,24,25,26)/p-4/t14-,15-,16?/m1/s1 |
| InChIKey | OJFSGMKRNQDISU-YGFGXBMJSA-J |
| XLogP | -1.79 |
| TPSA | 246.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.29 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|