C31H52N5O16P3 — CID 59414833
[[(1R,4R)-4-[5-[3-[6-(6-acetamidohexanoylamino)hexanoylamino]prop-1-ynyl]-2,4-dioxopyrimidin-1-yl]-2-hydroxycyclopentyl]methoxy-methoxyphosphoryl] dimethoxyphosphoryl methyl phosphate (PubChem CID 59414833) has the molecular formula C31H52N5O16P3 and a molecular weight of 843.70 g/mol. Its IUPAC name is [[(1R,4R)-4-[5-[3-[6-(6-acetamidohexanoylamino)hexanoylamino]prop-1-ynyl]-2,4-dioxopyrimidin-1-yl]-2-hydroxycyclopentyl]methoxy-methoxyphosphoryl] dimethoxyphosphoryl methyl phosphate.
| Compound Name | [[(1R,4R)-4-[5-[3-[6-(6-acetamidohexanoylamino)hexanoylamino]prop-1-ynyl]-2,4-dioxopyrimidin-1-yl]-2-hydroxycyclopentyl]methoxy-methoxyphosphoryl] dimethoxyphosphoryl methyl phosphate |
|---|---|
| PubChem CID | 59414833 |
| Molecular Formula | C31H52N5O16P3 |
| Molecular Weight | 843.70 g/mol |
| Exact Mass | 843.26 |
| IUPAC Name | [[(1R,4R)-4-[5-[3-[6-(6-acetamidohexanoylamino)hexanoylamino]prop-1-ynyl]-2,4-dioxopyrimidin-1-yl]-2-hydroxycyclopentyl]methoxy-methoxyphosphoryl] dimethoxyphosphoryl methyl phosphate |
| SMILES | COP(=O)(OC)OP(=O)(OC)OP(=O)(OC)OC[C@H]1C[C@@H](n2cc(C#CCNC(=O)CCCCCNC(=O)CCCCCNC(C)=O)c(=O)[nH]c2=O)CC1O |
| InChI | InChI=1S/C31H52N5O16P3/c1-23(37)32-16-10-6-8-14-28(39)33-17-11-7-9-15-29(40)34-18-12-13-24-21-36(31(42)35-30(24)41)26-19-25(27(38)20-26)22-50-54(44,48-4)52-55(45,49-5)51-53(43,46-2)47-3/h21,25-27,38H,6-11,14-20,22H2,1-5H3,(H,32,37)(H,33,39)(H,34,40)(H,35,41,42)/t25-,26-,27?,54?,55?/m1/s1 |
| InChIKey | DWXVDWGBJBJPAR-KACBUJIJSA-N |
| XLogP | 2.65 |
| TPSA | 278.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.70 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|