C17H17NO6S — CID 154605941
(4-methylphenyl) [4,5-bis(hydroxymethyl)-2-nitrophenyl]methylsulfanylformate (PubChem CID 154605941) has the molecular formula C17H17NO6S and a molecular weight of 363.39 g/mol. Its IUPAC name is (4-methylphenyl) [4,5-bis(hydroxymethyl)-2-nitrophenyl]methylsulfanylformate.
| Compound Name | (4-methylphenyl) [4,5-bis(hydroxymethyl)-2-nitrophenyl]methylsulfanylformate |
|---|---|
| PubChem CID | 154605941 |
| Molecular Formula | C17H17NO6S |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | (4-methylphenyl) [4,5-bis(hydroxymethyl)-2-nitrophenyl]methylsulfanylformate |
| SMILES | Cc1ccc(OC(=O)SCc2cc(CO)c(CO)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H17NO6S/c1-11-2-4-15(5-3-11)24-17(21)25-10-14-6-12(8-19)13(9-20)7-16(14)18(22)23/h2-7,19-20H,8-10H2,1H3 |
| InChIKey | KQELAAAROSVZRS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|