C16H14FNO6S — CID 154606107
[4,5-bis(hydroxymethyl)-2-nitrophenyl]methoxy-(4-fluorophenoxy)methanethione (PubChem CID 154606107) has the molecular formula C16H14FNO6S and a molecular weight of 367.35 g/mol. Its IUPAC name is [4,5-bis(hydroxymethyl)-2-nitrophenyl]methoxy-(4-fluorophenoxy)methanethione.
| Compound Name | [4,5-bis(hydroxymethyl)-2-nitrophenyl]methoxy-(4-fluorophenoxy)methanethione |
|---|---|
| PubChem CID | 154606107 |
| Molecular Formula | C16H14FNO6S |
| Molecular Weight | 367.35 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | [4,5-bis(hydroxymethyl)-2-nitrophenyl]methoxy-(4-fluorophenoxy)methanethione |
| SMILES | O=[N+]([O-])c1cc(CO)c(CO)cc1COC(=S)Oc1ccc(F)cc1 |
| InChI | InChI=1S/C16H14FNO6S/c17-13-1-3-14(4-2-13)24-16(25)23-9-12-5-10(7-19)11(8-20)6-15(12)18(21)22/h1-6,19-20H,7-9H2 |
| InChIKey | ROQULWNRXLCCKK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|