C16H15FN2O5S — CID 154605899
O-[[4,5-bis(hydroxymethyl)-2-nitrophenyl]methyl] N-(4-fluorophenyl)carbamothioate (PubChem CID 154605899) has the molecular formula C16H15FN2O5S and a molecular weight of 366.37 g/mol. Its IUPAC name is O-[[4,5-bis(hydroxymethyl)-2-nitrophenyl]methyl] N-(4-fluorophenyl)carbamothioate.
| Compound Name | O-[[4,5-bis(hydroxymethyl)-2-nitrophenyl]methyl] N-(4-fluorophenyl)carbamothioate |
|---|---|
| PubChem CID | 154605899 |
| Molecular Formula | C16H15FN2O5S |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | O-[[4,5-bis(hydroxymethyl)-2-nitrophenyl]methyl] N-(4-fluorophenyl)carbamothioate |
| SMILES | O=[N+]([O-])c1cc(CO)c(CO)cc1COC(=S)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C16H15FN2O5S/c17-13-1-3-14(4-2-13)18-16(25)24-9-12-5-10(7-20)11(8-21)6-15(12)19(22)23/h1-6,20-21H,7-9H2,(H,18,25) |
| InChIKey | YASNNNYJKCLDTI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|