C8H8IO- — CID 154609611
4-iodo-2,6-dimethylphenolate (PubChem CID 154609611) has the molecular formula C8H8IO- and a molecular weight of 247.05 g/mol. Its IUPAC name is 4-iodo-2,6-dimethylphenolate.
| Compound Name | 4-iodo-2,6-dimethylphenolate |
|---|---|
| PubChem CID | 154609611 |
| Molecular Formula | C8H8IO- |
| Molecular Weight | 247.05 g/mol |
| Exact Mass | 246.96 |
| IUPAC Name | 4-iodo-2,6-dimethylphenolate |
| SMILES | Cc1cc(I)cc(C)c1[O-] |
| InChI | InChI=1S/C8H9IO/c1-5-3-7(9)4-6(2)8(5)10/h3-4,10H,1-2H3/p-1 |
| InChIKey | HUUNIMCCAGNBDF-UHFFFAOYSA-M |
| XLogP | 1.98 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.05 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|