C47H44N4O — CID 154620018
(3Z)-3-[cyano(isocyano)methylidene]-2-[10-(dipropylamino)anthracen-9-yl]-4-(10-dipropylazaniumylideneanthracen-9-ylidene)cyclobuten-1-olate (PubChem CID 154620018) has the molecular formula C47H44N4O and a molecular weight of 680.90 g/mol. Its IUPAC name is (3Z)-3-[cyano(isocyano)methylidene]-2-[10-(dipropylamino)anthracen-9-yl]-4-(10-dipropylazaniumylideneanthracen-9-ylidene)cyclobuten-1-olate.
| Compound Name | (3Z)-3-[cyano(isocyano)methylidene]-2-[10-(dipropylamino)anthracen-9-yl]-4-(10-dipropylazaniumylideneanthracen-9-ylidene)cyclobuten-1-olate |
|---|---|
| PubChem CID | 154620018 |
| Molecular Formula | C47H44N4O |
| Molecular Weight | 680.90 g/mol |
| Exact Mass | 680.35 |
| IUPAC Name | (3Z)-3-[cyano(isocyano)methylidene]-2-[10-(dipropylamino)anthracen-9-yl]-4-(10-dipropylazaniumylideneanthracen-9-ylidene)cyclobuten-1-olate |
| SMILES | [C-]#[N+]/C(C#N)=C1\C(=C2c3ccccc3C(=[N+](CCC)CCC)c3ccccc32)C([O-])=C1c1c2ccccc2c(N(CCC)CCC)c2ccccc12 |
| InChI | InChI=1S/C47H44N4O/c1-6-26-50(27-7-2)45-35-22-14-10-18-31(35)40(32-19-11-15-23-36(32)45)43-42(39(30-48)49-5)44(47(43)52)41-33-20-12-16-24-37(33)46(51(28-8-3)29-9-4)38-25-17-13-21-34(38)41/h10-25H,6-9,26-29H2,1-4H3 |
| InChIKey | FRFIZLUZANIXIB-UHFFFAOYSA-N |
| XLogP | 9.89 |
| TPSA | 57.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.90 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|