C59H69N4O+ — CID 154619969
[10-[4-[cyano(isocyano)methylidene]-3-[10-(dihexylamino)anthracen-9-yl]-2-hydroxycyclobut-2-en-1-ylidene]anthracen-9-ylidene]-dihexylazanium (PubChem CID 154619969) has the molecular formula C59H69N4O+ and a molecular weight of 850.23 g/mol. Its IUPAC name is [10-[4-[cyano(isocyano)methylidene]-3-[10-(dihexylamino)anthracen-9-yl]-2-hydroxycyclobut-2-en-1-ylidene]anthracen-9-ylidene]-dihexylazanium.
| Compound Name | [10-[4-[cyano(isocyano)methylidene]-3-[10-(dihexylamino)anthracen-9-yl]-2-hydroxycyclobut-2-en-1-ylidene]anthracen-9-ylidene]-dihexylazanium |
|---|---|
| PubChem CID | 154619969 |
| Molecular Formula | C59H69N4O+ |
| Molecular Weight | 850.23 g/mol |
| Exact Mass | 849.55 |
| IUPAC Name | [10-[4-[cyano(isocyano)methylidene]-3-[10-(dihexylamino)anthracen-9-yl]-2-hydroxycyclobut-2-en-1-ylidene]anthracen-9-ylidene]-dihexylazanium |
| SMILES | [C-]#[N+]C(C#N)=C1C(=C2c3ccccc3C(=[N+](CCCCCC)CCCCCC)c3ccccc32)C(O)=C1c1c2ccccc2c(N(CCCCCC)CCCCCC)c2ccccc12 |
| InChI | InChI=1S/C59H68N4O/c1-6-10-14-26-38-62(39-27-15-11-7-2)57-47-34-22-18-30-43(47)52(44-31-19-23-35-48(44)57)55-54(51(42-60)61-5)56(59(55)64)53-45-32-20-24-36-49(45)58(50-37-25-21-33-46(50)53)63(40-28-16-12-8-3)41-29-17-13-9-4/h18-25,30-37H,6-17,26-29,38-41H2,1-4H3/p+1 |
| InChIKey | UGRCNYXECRWURC-UHFFFAOYSA-O |
| XLogP | 15.77 |
| TPSA | 54.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.23 |
| LogP ≤ 5 | 15.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|