C47H45N5O — CID 154619442
(3E)-2-[1-amino-10-(dipropylamino)anthracen-9-yl]-3-[cyano(isocyano)methylidene]-4-(10-dipropylazaniumylideneanthracen-9-ylidene)cyclobuten-1-olate (PubChem CID 154619442) has the molecular formula C47H45N5O and a molecular weight of 695.91 g/mol. Its IUPAC name is (3E)-2-[1-amino-10-(dipropylamino)anthracen-9-yl]-3-[cyano(isocyano)methylidene]-4-(10-dipropylazaniumylideneanthracen-9-ylidene)cyclobuten-1-olate.
| Compound Name | (3E)-2-[1-amino-10-(dipropylamino)anthracen-9-yl]-3-[cyano(isocyano)methylidene]-4-(10-dipropylazaniumylideneanthracen-9-ylidene)cyclobuten-1-olate |
|---|---|
| PubChem CID | 154619442 |
| Molecular Formula | C47H45N5O |
| Molecular Weight | 695.91 g/mol |
| Exact Mass | 695.36 |
| IUPAC Name | (3E)-2-[1-amino-10-(dipropylamino)anthracen-9-yl]-3-[cyano(isocyano)methylidene]-4-(10-dipropylazaniumylideneanthracen-9-ylidene)cyclobuten-1-olate |
| SMILES | [C-]#[N+]/C(C#N)=C1\C(=C2c3ccccc3C(=[N+](CCC)CCC)c3ccccc32)C([O-])=C1c1c2ccccc2c(N(CCC)CCC)c2cccc(N)c12 |
| InChI | InChI=1S/C47H45N5O/c1-6-25-51(26-7-2)45-33-20-13-10-17-30(33)39(31-18-11-14-21-34(31)45)43-42(38(29-48)50-5)44(47(43)53)41-32-19-12-15-22-35(32)46(52(27-8-3)28-9-4)36-23-16-24-37(49)40(36)41/h10-24H,6-9,25-28,49H2,1-4H3/b42-38+ |
| InChIKey | IJLFGQSARAIBOJ-WUHPQKATSA-N |
| XLogP | 9.47 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.91 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|