About 8-propan-2-yl-2,3-dihydro-[1,4]dioxino[2,3-c]pyridine
8-propan-2-yl-2,3-dihydro-[1,4]dioxino[2,3-c]pyridine (PubChem CID 154620164) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is 8-propan-2-yl-2,3-dihydro-[1,4]dioxino[2,3-c]pyridine.
Analyze 8-propan-2-yl-2,3-dihydro-[1,4]dioxino[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-propan-2-yl-2,3-dihydro-[1,4]dioxino[2,3-c]pyridine?
The IUPAC name of 8-propan-2-yl-2,3-dihydro-[1,4]dioxino[2,3-c]pyridine (CID 154620164) is 8-propan-2-yl-2,3-dihydro-[1,4]dioxino[2,3-c]pyridine.
What is the SMILES notation for 8-propan-2-yl-2,3-dihydro-[1,4]dioxino[2,3-c]pyridine?
The canonical SMILES for 8-propan-2-yl-2,3-dihydro-[1,4]dioxino[2,3-c]pyridine is CC(C)c1cncc2c1OCCO2.
What is the InChIKey of 8-propan-2-yl-2,3-dihydro-[1,4]dioxino[2,3-c]pyridine?
The InChIKey is RQTFVKSIJOYECL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c1-7(2)8-5-11-6-9-10(8)13-4-3-12-9/h5-7H,3-4H2,1-2H3.
What are the key properties of 8-propan-2-yl-2,3-dihydro-[1,4]dioxino[2,3-c]pyridine?
8-propan-2-yl-2,3-dihydro-[1,4]dioxino[2,3-c]pyridine has a molecular weight of 179.22 g/mol, XLogP of 1.98, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-propan-2-yl-2,3-dihydro-[1,4]dioxino[2,3-c]pyridine is sourced from PubChem (CID 154620164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).