C27H41FIN5O6 — CID 154628108
tert-butyl N-[(E)-C-(3,5-dimethyl-4-oxo-1,3,5-triazinan-1-yl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbonimidoyl]-N-[2-[3-fluoro-4-(3-iodopropoxy)phenyl]ethyl]carbamate (PubChem CID 154628108) has the molecular formula C27H41FIN5O6 and a molecular weight of 677.56 g/mol. Its IUPAC name is tert-butyl N-[(E)-C-(3,5-dimethyl-4-oxo-1,3,5-triazinan-1-yl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbonimidoyl]-N-[2-[3-fluoro-4-(3-iodopropoxy)phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[(E)-C-(3,5-dimethyl-4-oxo-1,3,5-triazinan-1-yl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbonimidoyl]-N-[2-[3-fluoro-4-(3-iodopropoxy)phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 154628108 |
| Molecular Formula | C27H41FIN5O6 |
| Molecular Weight | 677.56 g/mol |
| Exact Mass | 677.21 |
| IUPAC Name | tert-butyl N-[(E)-C-(3,5-dimethyl-4-oxo-1,3,5-triazinan-1-yl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbonimidoyl]-N-[2-[3-fluoro-4-(3-iodopropoxy)phenyl]ethyl]carbamate |
| SMILES | CN1CN(/C(=N\C(=O)OC(C)(C)C)N(CCc2ccc(OCCCI)c(F)c2)C(=O)OC(C)(C)C)CN(C)C1=O |
| InChI | InChI=1S/C27H41FIN5O6/c1-26(2,3)39-23(35)30-22(33-17-31(7)24(36)32(8)18-33)34(25(37)40-27(4,5)6)14-12-19-10-11-21(20(28)16-19)38-15-9-13-29/h10-11,16H,9,12-15,17-18H2,1-8H3/b30-22+ |
| InChIKey | KPMFVXRSDFGYDA-JBASAIQMSA-N |
| XLogP | 5.31 |
| TPSA | 104.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.56 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|