C20H30IN5O3 — CID 155000335
tert-butyl N-[C-(3,5-dimethyl-4-oxo-1,3,5-triazinan-1-yl)-N-[2-(3-iodo-4-methylphenyl)ethyl]carbonimidoyl]carbamate (PubChem CID 155000335) has the molecular formula C20H30IN5O3 and a molecular weight of 515.40 g/mol. Its IUPAC name is tert-butyl N-[C-(3,5-dimethyl-4-oxo-1,3,5-triazinan-1-yl)-N-[2-(3-iodo-4-methylphenyl)ethyl]carbonimidoyl]carbamate.
| Compound Name | tert-butyl N-[C-(3,5-dimethyl-4-oxo-1,3,5-triazinan-1-yl)-N-[2-(3-iodo-4-methylphenyl)ethyl]carbonimidoyl]carbamate |
|---|---|
| PubChem CID | 155000335 |
| Molecular Formula | C20H30IN5O3 |
| Molecular Weight | 515.40 g/mol |
| Exact Mass | 515.14 |
| IUPAC Name | tert-butyl N-[C-(3,5-dimethyl-4-oxo-1,3,5-triazinan-1-yl)-N-[2-(3-iodo-4-methylphenyl)ethyl]carbonimidoyl]carbamate |
| SMILES | Cc1ccc(CC/N=C(\NC(=O)OC(C)(C)C)N2CN(C)C(=O)N(C)C2)cc1I |
| InChI | InChI=1S/C20H30IN5O3/c1-14-7-8-15(11-16(14)21)9-10-22-17(23-18(27)29-20(2,3)4)26-12-24(5)19(28)25(6)13-26/h7-8,11H,9-10,12-13H2,1-6H3,(H,22,23,27) |
| InChIKey | RGPNCKDNAJKKRN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.40 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|