C21H20N4O3S — CID 154636977
(2S)-N-(4-methyl-2-nitrophenyl)-2-(5-phenyl-1,3-thiazol-2-yl)pyrrolidine-1-carboxamide (PubChem CID 154636977) has the molecular formula C21H20N4O3S and a molecular weight of 408.48 g/mol. Its IUPAC name is (2S)-N-(4-methyl-2-nitrophenyl)-2-(5-phenyl-1,3-thiazol-2-yl)pyrrolidine-1-carboxamide.
| Compound Name | (2S)-N-(4-methyl-2-nitrophenyl)-2-(5-phenyl-1,3-thiazol-2-yl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 154636977 |
| Molecular Formula | C21H20N4O3S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | (2S)-N-(4-methyl-2-nitrophenyl)-2-(5-phenyl-1,3-thiazol-2-yl)pyrrolidine-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)N2CCC[C@H]2c2ncc(-c3ccccc3)s2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H20N4O3S/c1-14-9-10-16(18(12-14)25(27)28)23-21(26)24-11-5-8-17(24)20-22-13-19(29-20)15-6-3-2-4-7-15/h2-4,6-7,9-10,12-13,17H,5,8,11H2,1H3,(H,23,26)/t17-/m0/s1 |
| InChIKey | FGDPMXRJRHRZPX-KRWDZBQOSA-N |
| XLogP | 5.40 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|