C16H14O4 — CID 154641182
5,7-dimethoxy-2-phenyl-2H-1-benzofuran-4-one (PubChem CID 154641182) has the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. Its IUPAC name is 5,7-dimethoxy-2-phenyl-2H-1-benzofuran-4-one.
| Compound Name | 5,7-dimethoxy-2-phenyl-2H-1-benzofuran-4-one |
|---|---|
| PubChem CID | 154641182 |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 5,7-dimethoxy-2-phenyl-2H-1-benzofuran-4-one |
| SMILES | COC1=CC(OC)=C2OC(c3ccccc3)C=C2C1=O |
| InChI | InChI=1S/C16H14O4/c1-18-13-9-14(19-2)16-11(15(13)17)8-12(20-16)10-6-4-3-5-7-10/h3-9,12H,1-2H3 |
| InChIKey | IWYMSRIJUTUXNZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |