C18H23ClFN3 — CID 154646250
1-[[4-(6-fluoroquinolin-4-yl)piperidin-1-yl]methyl]cyclopropan-1-amine;hydrochloride (PubChem CID 154646250) has the molecular formula C18H23ClFN3 and a molecular weight of 335.85 g/mol. Its IUPAC name is 1-[[4-(6-fluoroquinolin-4-yl)piperidin-1-yl]methyl]cyclopropan-1-amine;hydrochloride.
| Compound Name | 1-[[4-(6-fluoroquinolin-4-yl)piperidin-1-yl]methyl]cyclopropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 154646250 |
| Molecular Formula | C18H23ClFN3 |
| Molecular Weight | 335.85 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 1-[[4-(6-fluoroquinolin-4-yl)piperidin-1-yl]methyl]cyclopropan-1-amine;hydrochloride |
| SMILES | Cl.NC1(CN2CCC(c3ccnc4ccc(F)cc34)CC2)CC1 |
| InChI | InChI=1S/C18H22FN3.ClH/c19-14-1-2-17-16(11-14)15(3-8-21-17)13-4-9-22(10-5-13)12-18(20)6-7-18;/h1-3,8,11,13H,4-7,9-10,12,20H2;1H |
| InChIKey | MBRBAMIDUZCGGD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.85 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |