C10H15N3 — CID 154649429
2-[(3E,5Z)-2-methylhepta-1,3,5-trien-3-yl]-1-methylideneguanidine (PubChem CID 154649429) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is 2-[(3E,5Z)-2-methylhepta-1,3,5-trien-3-yl]-1-methylideneguanidine.
| Compound Name | 2-[(3E,5Z)-2-methylhepta-1,3,5-trien-3-yl]-1-methylideneguanidine |
|---|---|
| PubChem CID | 154649429 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 2-[(3E,5Z)-2-methylhepta-1,3,5-trien-3-yl]-1-methylideneguanidine |
| SMILES | C=N/C(N)=N\C(=C\C=C/C)C(=C)C |
| InChI | InChI=1S/C10H15N3/c1-5-6-7-9(8(2)3)13-10(11)12-4/h5-7H,2,4H2,1,3H3,(H2,11,13)/b6-5-,9-7+ |
| InChIKey | OJGCNWBPWORXMU-BZWSEGBZSA-N |
| XLogP | 2.04 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|