C25H33F3N4O4 — CID 154660821
tert-butyl N-[2-[5-[3-[4-methoxy-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]cyclooctyl]ethanimidoyl]carbamate (PubChem CID 154660821) has the molecular formula C25H33F3N4O4 and a molecular weight of 510.56 g/mol. Its IUPAC name is tert-butyl N-[2-[5-[3-[4-methoxy-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]cyclooctyl]ethanimidoyl]carbamate.
| Compound Name | tert-butyl N-[2-[5-[3-[4-methoxy-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]cyclooctyl]ethanimidoyl]carbamate |
|---|---|
| PubChem CID | 154660821 |
| Molecular Formula | C25H33F3N4O4 |
| Molecular Weight | 510.56 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | tert-butyl N-[2-[5-[3-[4-methoxy-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]cyclooctyl]ethanimidoyl]carbamate |
| SMILES | [H]/N=C(/CC1CCCC(c2nc(-c3ccc(OC)c(C(F)(F)F)c3)no2)CCC1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H33F3N4O4/c1-24(2,3)35-23(33)30-20(29)13-15-7-5-9-16(10-6-8-15)22-31-21(32-36-22)17-11-12-19(34-4)18(14-17)25(26,27)28/h11-12,14-16H,5-10,13H2,1-4H3,(H2,29,30,33) |
| InChIKey | XNHVPADHDLURRF-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 110.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.56 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|