C18H20N3O4P — CID 154673036
2-[4-[(6,8-dimethoxyquinazolin-4-yl)amino]phenyl]ethylphosphonous acid (PubChem CID 154673036) has the molecular formula C18H20N3O4P and a molecular weight of 373.35 g/mol. Its IUPAC name is 2-[4-[(6,8-dimethoxyquinazolin-4-yl)amino]phenyl]ethylphosphonous acid.
| Compound Name | 2-[4-[(6,8-dimethoxyquinazolin-4-yl)amino]phenyl]ethylphosphonous acid |
|---|---|
| PubChem CID | 154673036 |
| Molecular Formula | C18H20N3O4P |
| Molecular Weight | 373.35 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 2-[4-[(6,8-dimethoxyquinazolin-4-yl)amino]phenyl]ethylphosphonous acid |
| SMILES | COc1cc(OC)c2ncnc(Nc3ccc(CCP(O)O)cc3)c2c1 |
| InChI | InChI=1S/C18H20N3O4P/c1-24-14-9-15-17(16(10-14)25-2)19-11-20-18(15)21-13-5-3-12(4-6-13)7-8-26(22)23/h3-6,9-11,22-23H,7-8H2,1-2H3,(H,19,20,21) |
| InChIKey | VCJBJSIOTOAZLZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|