C20H22BrClF3N3O2 — CID 154673357
(3S,4S)-4-[(1E)-3-bromo-1-chloro-1-(dimethylamino)buta-1,3-dien-2-yl]-N-[2-(1,1-difluoroethyl)-3-fluorophenyl]-1-methyl-2-oxopyrrolidine-3-carboxamide (PubChem CID 154673357) has the molecular formula C20H22BrClF3N3O2 and a molecular weight of 508.77 g/mol. Its IUPAC name is (3S,4S)-4-[(1E)-3-bromo-1-chloro-1-(dimethylamino)buta-1,3-dien-2-yl]-N-[2-(1,1-difluoroethyl)-3-fluorophenyl]-1-methyl-2-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S,4S)-4-[(1E)-3-bromo-1-chloro-1-(dimethylamino)buta-1,3-dien-2-yl]-N-[2-(1,1-difluoroethyl)-3-fluorophenyl]-1-methyl-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 154673357 |
| Molecular Formula | C20H22BrClF3N3O2 |
| Molecular Weight | 508.77 g/mol |
| Exact Mass | 507.05 |
| IUPAC Name | (3S,4S)-4-[(1E)-3-bromo-1-chloro-1-(dimethylamino)buta-1,3-dien-2-yl]-N-[2-(1,1-difluoroethyl)-3-fluorophenyl]-1-methyl-2-oxopyrrolidine-3-carboxamide |
| SMILES | C=C(Br)/C(=C(/Cl)N(C)C)[C@H]1CN(C)C(=O)[C@@H]1C(=O)Nc1cccc(F)c1C(C)(F)F |
| InChI | InChI=1S/C20H22BrClF3N3O2/c1-10(21)14(17(22)27(3)4)11-9-28(5)19(30)15(11)18(29)26-13-8-6-7-12(23)16(13)20(2,24)25/h6-8,11,15H,1,9H2,2-5H3,(H,26,29)/b17-14+/t11-,15+/m1/s1 |
| InChIKey | XYDYBLNBXYWENW-ADKBPHHOSA-N |
| XLogP | 4.50 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.77 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|