C14H15BrClFN4O2S — CID 155039358
(3Z,3R,4S)-N-(1-chloroethenyl)-4-[(2-fluorothiophen-3-yl)carbamoyl]-N,1-dimethyl-5-oxopyrrolidine-3-carbohydrazonoyl bromide (PubChem CID 155039358) has the molecular formula C14H15BrClFN4O2S and a molecular weight of 437.72 g/mol. Its IUPAC name is (3Z,3R,4S)-N-(1-chloroethenyl)-4-[(2-fluorothiophen-3-yl)carbamoyl]-N,1-dimethyl-5-oxopyrrolidine-3-carbohydrazonoyl bromide.
| Compound Name | (3Z,3R,4S)-N-(1-chloroethenyl)-4-[(2-fluorothiophen-3-yl)carbamoyl]-N,1-dimethyl-5-oxopyrrolidine-3-carbohydrazonoyl bromide |
|---|---|
| PubChem CID | 155039358 |
| Molecular Formula | C14H15BrClFN4O2S |
| Molecular Weight | 437.72 g/mol |
| Exact Mass | 435.98 |
| IUPAC Name | (3Z,3R,4S)-N-(1-chloroethenyl)-4-[(2-fluorothiophen-3-yl)carbamoyl]-N,1-dimethyl-5-oxopyrrolidine-3-carbohydrazonoyl bromide |
| SMILES | C=C(Cl)N(C)/N=C(\Br)[C@H]1CN(C)C(=O)[C@@H]1C(=O)Nc1ccsc1F |
| InChI | InChI=1S/C14H15BrClFN4O2S/c1-7(16)21(3)19-11(15)8-6-20(2)14(23)10(8)13(22)18-9-4-5-24-12(9)17/h4-5,8,10H,1,6H2,2-3H3,(H,18,22)/b19-11-/t8-,10-/m0/s1 |
| InChIKey | RDPBCOHGLXLBCO-JLGUDTAVSA-N |
| XLogP | 2.88 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.72 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|