C14H16Cl2N4O2S — CID 154617893
(3S,4R)-4-(5-chloro-2-methyl-1,5-dihydropyrazol-3-yl)-N-(2-chlorothiophen-3-yl)-1-methyl-2-oxopyrrolidine-3-carboxamide (PubChem CID 154617893) has the molecular formula C14H16Cl2N4O2S and a molecular weight of 375.28 g/mol. Its IUPAC name is (3S,4R)-4-(5-chloro-2-methyl-1,5-dihydropyrazol-3-yl)-N-(2-chlorothiophen-3-yl)-1-methyl-2-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S,4R)-4-(5-chloro-2-methyl-1,5-dihydropyrazol-3-yl)-N-(2-chlorothiophen-3-yl)-1-methyl-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 154617893 |
| Molecular Formula | C14H16Cl2N4O2S |
| Molecular Weight | 375.28 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | (3S,4R)-4-(5-chloro-2-methyl-1,5-dihydropyrazol-3-yl)-N-(2-chlorothiophen-3-yl)-1-methyl-2-oxopyrrolidine-3-carboxamide |
| SMILES | CN1C[C@H](C2=CC(Cl)NN2C)[C@@H](C(=O)Nc2ccsc2Cl)C1=O |
| InChI | InChI=1S/C14H16Cl2N4O2S/c1-19-6-7(9-5-10(15)18-20(9)2)11(14(19)22)13(21)17-8-3-4-23-12(8)16/h3-5,7,10-11,18H,6H2,1-2H3,(H,17,21)/t7-,10?,11+/m1/s1 |
| InChIKey | NXIDHXUXIVGNGG-PEHSPWRBSA-N |
| XLogP | 1.94 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|