C17H16BrClF4N4O3 — CID 155039354
(3S,4R)-4-[(E)-1-bromo-2-chloro-2-[methyl-(methylideneamino)amino]ethenyl]-N-[3-fluoro-2-(trifluoromethoxy)phenyl]-1-methyl-2-oxopyrrolidine-3-carboxamide (PubChem CID 155039354) has the molecular formula C17H16BrClF4N4O3 and a molecular weight of 515.69 g/mol. Its IUPAC name is (3S,4R)-4-[(E)-1-bromo-2-chloro-2-[methyl-(methylideneamino)amino]ethenyl]-N-[3-fluoro-2-(trifluoromethoxy)phenyl]-1-methyl-2-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S,4R)-4-[(E)-1-bromo-2-chloro-2-[methyl-(methylideneamino)amino]ethenyl]-N-[3-fluoro-2-(trifluoromethoxy)phenyl]-1-methyl-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 155039354 |
| Molecular Formula | C17H16BrClF4N4O3 |
| Molecular Weight | 515.69 g/mol |
| Exact Mass | 514.00 |
| IUPAC Name | (3S,4R)-4-[(E)-1-bromo-2-chloro-2-[methyl-(methylideneamino)amino]ethenyl]-N-[3-fluoro-2-(trifluoromethoxy)phenyl]-1-methyl-2-oxopyrrolidine-3-carboxamide |
| SMILES | C=NN(C)/C(Cl)=C(\Br)[C@H]1CN(C)C(=O)[C@@H]1C(=O)Nc1cccc(F)c1OC(F)(F)F |
| InChI | InChI=1S/C17H16BrClF4N4O3/c1-24-27(3)14(19)12(18)8-7-26(2)16(29)11(8)15(28)25-10-6-4-5-9(20)13(10)30-17(21,22)23/h4-6,8,11H,1,7H2,2-3H3,(H,25,28)/b14-12-/t8-,11-/m0/s1 |
| InChIKey | MZWSAUMGGVMACV-PITIQDGTSA-N |
| XLogP | 3.72 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.69 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|